C26H30ClNO4 — CID 139082011
(1R,9S,10S,13S)-3-[(4-chlorophenyl)methoxy]-4,12-dimethoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-13-ol (PubChem CID 139082011) has the molecular formula C26H30ClNO4 and a molecular weight of 455.98 g/mol. Its IUPAC name is (1R,9S,10S,13S)-3-[(4-chlorophenyl)methoxy]-4,12-dimethoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-13-ol.
| Compound Name | (1R,9S,10S,13S)-3-[(4-chlorophenyl)methoxy]-4,12-dimethoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-13-ol |
|---|---|
| PubChem CID | 139082011 |
| Molecular Formula | C26H30ClNO4 |
| Molecular Weight | 455.98 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | (1R,9S,10S,13S)-3-[(4-chlorophenyl)methoxy]-4,12-dimethoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-13-ol |
| SMILES | COC1=C[C@@H]2[C@@H]3Cc4ccc(OC)c(OCc5ccc(Cl)cc5)c4[C@]2(CCN3C)C[C@@H]1O |
| InChI | InChI=1S/C26H30ClNO4/c1-28-11-10-26-14-21(29)23(31-3)13-19(26)20(28)12-17-6-9-22(30-2)25(24(17)26)32-15-16-4-7-18(27)8-5-16/h4-9,13,19-21,29H,10-12,14-15H2,1-3H3/t19-,20+,21+,26-/m1/s1 |
| InChIKey | WPRCENBLXCOXPJ-VSCPTIONSA-N |
| XLogP | 4.34 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.98 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |