C43H50N2O10 — CID 57393239
bis[(1R,9S,10S)-4,12-dimethoxy-17-methyl-13-oxo-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-3-yl] pentanedioate (PubChem CID 57393239) has the molecular formula C43H50N2O10 and a molecular weight of 754.88 g/mol. Its IUPAC name is bis[(1R,9S,10S)-4,12-dimethoxy-17-methyl-13-oxo-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-3-yl] pentanedioate.
| Compound Name | bis[(1R,9S,10S)-4,12-dimethoxy-17-methyl-13-oxo-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-3-yl] pentanedioate |
|---|---|
| PubChem CID | 57393239 |
| Molecular Formula | C43H50N2O10 |
| Molecular Weight | 754.88 g/mol |
| Exact Mass | 754.35 |
| IUPAC Name | bis[(1R,9S,10S)-4,12-dimethoxy-17-methyl-13-oxo-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-3-yl] pentanedioate |
| SMILES | COC1=C[C@@H]2[C@@H]3Cc4ccc(OC)c(OC(=O)CCCC(=O)Oc5c(OC)ccc6c5[C@@]57CCN(C)[C@@H](C6)[C@H]5C=C(OC)C(=O)C7)c4[C@]2(CCN3C)CC1=O |
| InChI | InChI=1S/C43H50N2O10/c1-44-16-14-42-22-30(46)34(52-5)20-26(42)28(44)18-24-10-12-32(50-3)40(38(24)42)54-36(48)8-7-9-37(49)55-41-33(51-4)13-11-25-19-29-27-21-35(53-6)31(47)23-43(27,39(25)41)15-17-45(29)2/h10-13,20-21,26-29H,7-9,14-19,22-23H2,1-6H3/t26-,27-,28+,29+,42-,43-/m1/s1 |
| InChIKey | SKJCUEHEDDWLAY-XVGIKKCMSA-N |
| XLogP | 4.62 |
| TPSA | 130.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.88 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|