C19H23NO3 — CID 70950652
(10R)-3,4-dimethoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-13-one (PubChem CID 70950652) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is (10R)-3,4-dimethoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-13-one.
| Compound Name | (10R)-3,4-dimethoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-13-one |
|---|---|
| PubChem CID | 70950652 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | (10R)-3,4-dimethoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-13-one |
| SMILES | COc1ccc2c(c1OC)C13CCN(C)C(C2)[C@@H]1C=CC(=O)C3 |
| InChI | InChI=1S/C19H23NO3/c1-20-9-8-19-11-13(21)5-6-14(19)15(20)10-12-4-7-16(22-2)18(23-3)17(12)19/h4-7,14-15H,8-11H2,1-3H3/t14-,15?,19?/m0/s1 |
| InChIKey | ILHJNLRDFYIULN-XVTSOASTSA-N |
| XLogP | 2.35 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |