C17H18BrNO4 — CID 71495911
6-bromo-3,4,12-trihydroxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6,11-tetraen-13-one (PubChem CID 71495911) has the molecular formula C17H18BrNO4 and a molecular weight of 380.24 g/mol. Its IUPAC name is 6-bromo-3,4,12-trihydroxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6,11-tetraen-13-one.
| Compound Name | 6-bromo-3,4,12-trihydroxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6,11-tetraen-13-one |
|---|---|
| PubChem CID | 71495911 |
| Molecular Formula | C17H18BrNO4 |
| Molecular Weight | 380.24 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | 6-bromo-3,4,12-trihydroxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6,11-tetraen-13-one |
| SMILES | CN1CCC23CC(=O)C(O)=CC2C1Cc1c(Br)cc(O)c(O)c13 |
| InChI | InChI=1S/C17H18BrNO4/c1-19-3-2-17-7-14(22)12(20)5-9(17)11(19)4-8-10(18)6-13(21)16(23)15(8)17/h5-6,9,11,20-21,23H,2-4,7H2,1H3 |
| InChIKey | STBMVEJURBZPQO-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.24 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|