C17H17Br2NO3 — CID 10456067
(4R,4aR,7aR,12bS)-6,11-dibromo-9-hydroxy-3-methyl-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one (PubChem CID 10456067) has the molecular formula C17H17Br2NO3 and a molecular weight of 443.14 g/mol. Its IUPAC name is (4R,4aR,7aR,12bS)-6,11-dibromo-9-hydroxy-3-methyl-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one.
| Compound Name | (4R,4aR,7aR,12bS)-6,11-dibromo-9-hydroxy-3-methyl-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
|---|---|
| PubChem CID | 10456067 |
| Molecular Formula | C17H17Br2NO3 |
| Molecular Weight | 443.14 g/mol |
| Exact Mass | 440.96 |
| IUPAC Name | (4R,4aR,7aR,12bS)-6,11-dibromo-9-hydroxy-3-methyl-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
| SMILES | CN1CC[C@]23c4c5c(Br)cc(O)c4O[C@H]2C(=O)C(Br)C[C@H]3[C@H]1C5 |
| InChI | InChI=1S/C17H17Br2NO3/c1-20-3-2-17-8-5-10(19)14(22)16(17)23-15-12(21)6-9(18)7(13(15)17)4-11(8)20/h6,8,10-11,16,21H,2-5H2,1H3/t8-,10?,11+,16-,17-/m0/s1 |
| InChIKey | DJWKOHOZBIQNBG-LDVNQLCOSA-N |
| XLogP | 2.77 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.14 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|