C18H19Br2NO4 — CID 10027810
(4R,4aS,6S,7aR,12bS)-6,11-dibromo-4a-hydroxy-9-methoxy-3-methyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one (PubChem CID 10027810) has the molecular formula C18H19Br2NO4 and a molecular weight of 473.16 g/mol. Its IUPAC name is (4R,4aS,6S,7aR,12bS)-6,11-dibromo-4a-hydroxy-9-methoxy-3-methyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one.
| Compound Name | (4R,4aS,6S,7aR,12bS)-6,11-dibromo-4a-hydroxy-9-methoxy-3-methyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
|---|---|
| PubChem CID | 10027810 |
| Molecular Formula | C18H19Br2NO4 |
| Molecular Weight | 473.16 g/mol |
| Exact Mass | 470.97 |
| IUPAC Name | (4R,4aS,6S,7aR,12bS)-6,11-dibromo-4a-hydroxy-9-methoxy-3-methyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
| SMILES | COc1cc(Br)c2c3c1O[C@H]1C(=O)[C@@H](Br)C[C@@]4(O)[C@@H](C2)N(C)CC[C@]314 |
| InChI | InChI=1S/C18H19Br2NO4/c1-21-4-3-17-13-8-5-12(21)18(17,23)7-10(20)14(22)16(17)25-15(13)11(24-2)6-9(8)19/h6,10,12,16,23H,3-5,7H2,1-2H3/t10-,12+,16-,17-,18+/m0/s1 |
| InChIKey | JOIWBECPBKCGJU-QDODQBBXSA-N |
| XLogP | 2.18 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.16 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|