C18H22BrNO4 — CID 59105823
(4R,4aS,7S,7aR,12bS)-11-bromo-9-methoxy-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,7-diol (PubChem CID 59105823) has the molecular formula C18H22BrNO4 and a molecular weight of 396.28 g/mol. Its IUPAC name is (4R,4aS,7S,7aR,12bS)-11-bromo-9-methoxy-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,7-diol.
| Compound Name | (4R,4aS,7S,7aR,12bS)-11-bromo-9-methoxy-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,7-diol |
|---|---|
| PubChem CID | 59105823 |
| Molecular Formula | C18H22BrNO4 |
| Molecular Weight | 396.28 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | (4R,4aS,7S,7aR,12bS)-11-bromo-9-methoxy-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,7-diol |
| SMILES | COc1cc(Br)c2c3c1O[C@H]1[C@@H](O)CC[C@@]4(O)[C@@H](C2)N(C)CC[C@]314 |
| InChI | InChI=1S/C18H22BrNO4/c1-20-6-5-17-14-9-7-13(20)18(17,22)4-3-11(21)16(17)24-15(14)12(23-2)8-10(9)19/h8,11,13,16,21-22H,3-7H2,1-2H3/t11-,13+,16-,17-,18+/m0/s1 |
| InChIKey | COBIJNBGRWQEGO-QMVVXIJUSA-N |
| XLogP | 1.60 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.28 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |