C18H23NO4 — CID 59105826
(4R,4aS,7S,7aR,12bS)-9-methoxy-3-methyl-11-tritio-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,7-diol (PubChem CID 59105826) has the molecular formula C18H23NO4 and a molecular weight of 319.39 g/mol. Its IUPAC name is (4R,4aS,7S,7aR,12bS)-9-methoxy-3-methyl-11-tritio-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,7-diol.
| Compound Name | (4R,4aS,7S,7aR,12bS)-9-methoxy-3-methyl-11-tritio-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,7-diol |
|---|---|
| PubChem CID | 59105826 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | (4R,4aS,7S,7aR,12bS)-9-methoxy-3-methyl-11-tritio-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,7-diol |
| SMILES | [3H]c1cc(OC)c2c3c1C[C@H]1N(C)CC[C@@]34[C@@H](O2)[C@@H](O)CC[C@@]14O |
| InChI | InChI=1S/C18H23NO4/c1-19-8-7-17-14-10-3-4-12(22-2)15(14)23-16(17)11(20)5-6-18(17,21)13(19)9-10/h3-4,11,13,16,20-21H,5-9H2,1-2H3/t11-,13+,16-,17-,18+/m0/s1/i3T |
| InChIKey | LHTAJTFGGUDLRH-QERDYMFGSA-N |
| XLogP | 0.84 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |