C27H32N2O3 — CID 71123667
(4R,4aS,7R,7aR,12bS)-7-(3,4-dihydro-2H-quinolin-1-yl)-9-methoxy-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-ol (PubChem CID 71123667) has the molecular formula C27H32N2O3 and a molecular weight of 432.56 g/mol. Its IUPAC name is (4R,4aS,7R,7aR,12bS)-7-(3,4-dihydro-2H-quinolin-1-yl)-9-methoxy-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-ol.
| Compound Name | (4R,4aS,7R,7aR,12bS)-7-(3,4-dihydro-2H-quinolin-1-yl)-9-methoxy-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-ol |
|---|---|
| PubChem CID | 71123667 |
| Molecular Formula | C27H32N2O3 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | (4R,4aS,7R,7aR,12bS)-7-(3,4-dihydro-2H-quinolin-1-yl)-9-methoxy-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-ol |
| SMILES | COc1ccc2c3c1O[C@H]1[C@H](N4CCCc5ccccc54)CC[C@@]4(O)[C@@H](C2)N(C)CC[C@]314 |
| InChI | InChI=1S/C27H32N2O3/c1-28-15-13-26-23-18-9-10-21(31-2)24(23)32-25(26)20(11-12-27(26,30)22(28)16-18)29-14-5-7-17-6-3-4-8-19(17)29/h3-4,6,8-10,20,22,25,30H,5,7,11-16H2,1-2H3/t20-,22-,25+,26+,27-/m1/s1 |
| InChIKey | XUBMGHAXWVRHDS-GIBBRDMCSA-N |
| XLogP | 3.30 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |