C22H26BrNO3 — CID 70547914
(4R,4aR,6S,7aR,12bS)-11-bromo-3-(cyclopropylmethyl)-9-methoxy-6-methyl-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one (PubChem CID 70547914) has the molecular formula C22H26BrNO3 and a molecular weight of 432.36 g/mol. Its IUPAC name is (4R,4aR,6S,7aR,12bS)-11-bromo-3-(cyclopropylmethyl)-9-methoxy-6-methyl-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one.
| Compound Name | (4R,4aR,6S,7aR,12bS)-11-bromo-3-(cyclopropylmethyl)-9-methoxy-6-methyl-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
|---|---|
| PubChem CID | 70547914 |
| Molecular Formula | C22H26BrNO3 |
| Molecular Weight | 432.36 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | (4R,4aR,6S,7aR,12bS)-11-bromo-3-(cyclopropylmethyl)-9-methoxy-6-methyl-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
| SMILES | COc1cc(Br)c2c3c1O[C@H]1C(=O)[C@@H](C)C[C@H]4[C@@H](C2)N(CC2CC2)CC[C@]314 |
| InChI | InChI=1S/C22H26BrNO3/c1-11-7-14-16-8-13-15(23)9-17(26-2)20-18(13)22(14,21(27-20)19(11)25)5-6-24(16)10-12-3-4-12/h9,11-12,14,16,21H,3-8,10H2,1-2H3/t11-,14-,16+,21-,22-/m0/s1 |
| InChIKey | QLVFQAZCTFNHJV-DCVAEEPOSA-N |
| XLogP | 3.72 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.36 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |