C23H28BrNO3 — CID 173439108
(4R,4aR,5R,6S,12bS)-11-bromo-3-(cyclopropylmethyl)-9-methoxy-5,6-dimethyl-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one (PubChem CID 173439108) has the molecular formula C23H28BrNO3 and a molecular weight of 446.39 g/mol. Its IUPAC name is (4R,4aR,5R,6S,12bS)-11-bromo-3-(cyclopropylmethyl)-9-methoxy-5,6-dimethyl-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one.
| Compound Name | (4R,4aR,5R,6S,12bS)-11-bromo-3-(cyclopropylmethyl)-9-methoxy-5,6-dimethyl-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
|---|---|
| PubChem CID | 173439108 |
| Molecular Formula | C23H28BrNO3 |
| Molecular Weight | 446.39 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | (4R,4aR,5R,6S,12bS)-11-bromo-3-(cyclopropylmethyl)-9-methoxy-5,6-dimethyl-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
| SMILES | COc1cc(Br)c2c3c1OC1C(=O)[C@@H](C)[C@H](C)[C@H]4[C@@H](C2)N(CC2CC2)CC[C@]314 |
| InChI | InChI=1S/C23H28BrNO3/c1-11-12(2)20(26)22-23-6-7-25(10-13-4-5-13)16(18(11)23)8-14-15(24)9-17(27-3)21(28-22)19(14)23/h9,11-13,16,18,22H,4-8,10H2,1-3H3/t11-,12-,16+,18-,22?,23-/m0/s1 |
| InChIKey | LOFXOVREAFUTPN-ZKHUDKRGSA-N |
| XLogP | 3.97 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.39 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |