C18H20BrNO4 — CID 53241849
(1R,9S)-6-bromo-3-hydroxy-4,12-dimethoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6,11-tetraen-13-one (PubChem CID 53241849) has the molecular formula C18H20BrNO4 and a molecular weight of 394.27 g/mol. Its IUPAC name is (1R,9S)-6-bromo-3-hydroxy-4,12-dimethoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6,11-tetraen-13-one.
| Compound Name | (1R,9S)-6-bromo-3-hydroxy-4,12-dimethoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6,11-tetraen-13-one |
|---|---|
| PubChem CID | 53241849 |
| Molecular Formula | C18H20BrNO4 |
| Molecular Weight | 394.27 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | (1R,9S)-6-bromo-3-hydroxy-4,12-dimethoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6,11-tetraen-13-one |
| SMILES | COC1=CC2[C@@H]3Cc4c(Br)cc(OC)c(O)c4[C@]2(CCN3)CC1=O |
| InChI | InChI=1S/C18H20BrNO4/c1-23-14-6-10-12-5-9-11(19)7-15(24-2)17(22)16(9)18(10,3-4-20-12)8-13(14)21/h6-7,10,12,20,22H,3-5,8H2,1-2H3/t10?,12-,18+/m0/s1 |
| InChIKey | WAKHJQIJWHBXFE-WYEBJZBISA-N |
| XLogP | 2.44 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.27 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |