C20H25NO5 — CID 46928140
(1R,8R,9R)-3-hydroxy-4,8,12-trimethoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-13-one (PubChem CID 46928140) has the molecular formula C20H25NO5 and a molecular weight of 359.42 g/mol. Its IUPAC name is (1R,8R,9R)-3-hydroxy-4,8,12-trimethoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-13-one.
| Compound Name | (1R,8R,9R)-3-hydroxy-4,8,12-trimethoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-13-one |
|---|---|
| PubChem CID | 46928140 |
| Molecular Formula | C20H25NO5 |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | (1R,8R,9R)-3-hydroxy-4,8,12-trimethoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-13-one |
| SMILES | COC1=CC2[C@@H]3[C@H](OC)c4ccc(OC)c(O)c4[C@]2(CCN3C)CC1=O |
| InChI | InChI=1S/C20H25NO5/c1-21-8-7-20-10-13(22)15(25-3)9-12(20)17(21)19(26-4)11-5-6-14(24-2)18(23)16(11)20/h5-6,9,12,17,19,23H,7-8,10H2,1-4H3/t12?,17-,19-,20-/m1/s1 |
| InChIKey | KKXQLZYQAIHILX-HVNDSYIDSA-N |
| XLogP | 2.16 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |