C19H26ClNO4 — CID 71583236
(1R,9S,10S,13S)-6-chloro-4,12-dimethoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-triene-3,13-diol (PubChem CID 71583236) has the molecular formula C19H26ClNO4 and a molecular weight of 367.87 g/mol. Its IUPAC name is (1R,9S,10S,13S)-6-chloro-4,12-dimethoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-triene-3,13-diol.
| Compound Name | (1R,9S,10S,13S)-6-chloro-4,12-dimethoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-triene-3,13-diol |
|---|---|
| PubChem CID | 71583236 |
| Molecular Formula | C19H26ClNO4 |
| Molecular Weight | 367.87 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | (1R,9S,10S,13S)-6-chloro-4,12-dimethoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-triene-3,13-diol |
| SMILES | COc1cc(Cl)c2c(c1O)[C@@]13CCN(C)[C@@H](C2)[C@H]1CC(OC)[C@@H](O)C3 |
| InChI | InChI=1S/C19H26ClNO4/c1-21-5-4-19-9-14(22)15(24-2)7-11(19)13(21)6-10-12(20)8-16(25-3)18(23)17(10)19/h8,11,13-15,22-23H,4-7,9H2,1-3H3/t11-,13+,14+,15?,19-/m1/s1 |
| InChIKey | SJWXQYFVGRWNSQ-QWWPIBPRSA-N |
| XLogP | 2.34 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.87 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |