C21H29NO4 — CID 50924237
(1R,9S,10S)-4,12-dimethoxy-17-prop-2-enyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-3,13-diol (PubChem CID 50924237) has the molecular formula C21H29NO4 and a molecular weight of 359.47 g/mol. Its IUPAC name is (1R,9S,10S)-4,12-dimethoxy-17-prop-2-enyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-3,13-diol.
| Compound Name | (1R,9S,10S)-4,12-dimethoxy-17-prop-2-enyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-3,13-diol |
|---|---|
| PubChem CID | 50924237 |
| Molecular Formula | C21H29NO4 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | (1R,9S,10S)-4,12-dimethoxy-17-prop-2-enyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-3,13-diol |
| SMILES | C=CCN1CC[C@@]23CC(O)C(OC)C[C@@H]2[C@@H]1Cc1ccc(OC)c(O)c13 |
| InChI | InChI=1S/C21H29NO4/c1-4-8-22-9-7-21-12-16(23)18(26-3)11-14(21)15(22)10-13-5-6-17(25-2)20(24)19(13)21/h4-6,14-16,18,23-24H,1,7-12H2,2-3H3/t14-,15+,16?,18?,21-/m1/s1 |
| InChIKey | KFNCXPSFZMODBC-IVUBAFOSSA-N |
| XLogP | 2.24 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|