C20H24FNO2 — CID 138720461
(4S,7aS)-7-fluoro-9-methoxy-3-prop-2-enyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline (PubChem CID 138720461) has the molecular formula C20H24FNO2 and a molecular weight of 329.41 g/mol. Its IUPAC name is (4S,7aS)-7-fluoro-9-methoxy-3-prop-2-enyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline.
| Compound Name | (4S,7aS)-7-fluoro-9-methoxy-3-prop-2-enyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline |
|---|---|
| PubChem CID | 138720461 |
| Molecular Formula | C20H24FNO2 |
| Molecular Weight | 329.41 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | (4S,7aS)-7-fluoro-9-methoxy-3-prop-2-enyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline |
| SMILES | C=CCN1CCC23c4c5ccc(OC)c4O[C@@H]2C(F)CCC3[C@@H]1C5 |
| InChI | InChI=1S/C20H24FNO2/c1-3-9-22-10-8-20-13-5-6-14(21)19(20)24-18-16(23-2)7-4-12(17(18)20)11-15(13)22/h3-4,7,13-15,19H,1,5-6,8-11H2,2H3/t13?,14?,15-,19+,20?/m0/s1 |
| InChIKey | WFDFRZHYIZEXKB-FWLNQSMWSA-N |
| XLogP | 3.26 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.41 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|