C23H24FNO2S — CID 163475092
(4S,7aS,12bR)-7-fluoro-9-methoxy-3-phenylsulfanyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline (PubChem CID 163475092) has the molecular formula C23H24FNO2S and a molecular weight of 397.52 g/mol. Its IUPAC name is (4S,7aS,12bR)-7-fluoro-9-methoxy-3-phenylsulfanyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline.
| Compound Name | (4S,7aS,12bR)-7-fluoro-9-methoxy-3-phenylsulfanyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline |
|---|---|
| PubChem CID | 163475092 |
| Molecular Formula | C23H24FNO2S |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | (4S,7aS,12bR)-7-fluoro-9-methoxy-3-phenylsulfanyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline |
| SMILES | COc1ccc2c3c1O[C@@H]1C(F)CCC4[C@H](C2)N(Sc2ccccc2)CC[C@]341 |
| InChI | InChI=1S/C23H24FNO2S/c1-26-19-10-7-14-13-18-16-8-9-17(24)22-23(16,20(14)21(19)27-22)11-12-25(18)28-15-5-3-2-4-6-15/h2-7,10,16-18,22H,8-9,11-13H2,1H3/t16?,17?,18-,22+,23+/m0/s1 |
| InChIKey | BZTPMRYLYIXOPS-PMHAQBEESA-N |
| XLogP | 4.78 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|