C23H37NO3Si2 — CID 6426553
(9-methoxy-3-trimethylsilyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl)oxy-trimethylsilane (PubChem CID 6426553) has the molecular formula C23H37NO3Si2 and a molecular weight of 431.73 g/mol. Its IUPAC name is (9-methoxy-3-trimethylsilyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl)oxy-trimethylsilane.
| Compound Name | (9-methoxy-3-trimethylsilyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl)oxy-trimethylsilane |
|---|---|
| PubChem CID | 6426553 |
| Molecular Formula | C23H37NO3Si2 |
| Molecular Weight | 431.73 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | (9-methoxy-3-trimethylsilyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl)oxy-trimethylsilane |
| SMILES | COc1ccc2c3c1OC1C(O[Si](C)(C)C)CCC4C(C2)N([Si](C)(C)C)CCC341 |
| InChI | InChI=1S/C23H37NO3Si2/c1-25-18-10-8-15-14-17-16-9-11-19(27-29(5,6)7)22-23(16,20(15)21(18)26-22)12-13-24(17)28(2,3)4/h8,10,16-17,19,22H,9,11-14H2,1-7H3 |
| InChIKey | YLSJDZOJIPKGOM-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.73 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|