C26H30FNO2 — CID 138720033
(4S,7aS,12bR)-7-fluoro-9-methoxy-3-(1-phenylpropan-2-yl)-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline (PubChem CID 138720033) has the molecular formula C26H30FNO2 and a molecular weight of 407.53 g/mol. Its IUPAC name is (4S,7aS,12bR)-7-fluoro-9-methoxy-3-(1-phenylpropan-2-yl)-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline.
| Compound Name | (4S,7aS,12bR)-7-fluoro-9-methoxy-3-(1-phenylpropan-2-yl)-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline |
|---|---|
| PubChem CID | 138720033 |
| Molecular Formula | C26H30FNO2 |
| Molecular Weight | 407.53 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | (4S,7aS,12bR)-7-fluoro-9-methoxy-3-(1-phenylpropan-2-yl)-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline |
| SMILES | COc1ccc2c3c1O[C@@H]1C(F)CCC4[C@H](C2)N(C(C)Cc2ccccc2)CC[C@]341 |
| InChI | InChI=1S/C26H30FNO2/c1-16(14-17-6-4-3-5-7-17)28-13-12-26-19-9-10-20(27)25(26)30-24-22(29-2)11-8-18(23(24)26)15-21(19)28/h3-8,11,16,19-21,25H,9-10,12-15H2,1-2H3/t16?,19?,20?,21-,25+,26+/m0/s1 |
| InChIKey | PUGYZZZGKLKLKA-UXSNMOMISA-N |
| XLogP | 4.70 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.53 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |