C19H25N3O4 — CID 130198483
(1R,9S,10R)-20-ethyl-9,15-dihydroxy-4,6,20-triazatetracyclo[8.7.3.01,9.012,17]icosa-12(17),13,15-triene-3,5-dione (PubChem CID 130198483) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is (1R,9S,10R)-20-ethyl-9,15-dihydroxy-4,6,20-triazatetracyclo[8.7.3.01,9.012,17]icosa-12(17),13,15-triene-3,5-dione.
| Compound Name | (1R,9S,10R)-20-ethyl-9,15-dihydroxy-4,6,20-triazatetracyclo[8.7.3.01,9.012,17]icosa-12(17),13,15-triene-3,5-dione |
|---|---|
| PubChem CID | 130198483 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | (1R,9S,10R)-20-ethyl-9,15-dihydroxy-4,6,20-triazatetracyclo[8.7.3.01,9.012,17]icosa-12(17),13,15-triene-3,5-dione |
| SMILES | CCN1CC[C@]23CC(=O)NC(=O)NCC[C@@]2(O)[C@H]1Cc1ccc(O)cc13 |
| InChI | InChI=1S/C19H25N3O4/c1-2-22-8-6-18-11-16(24)21-17(25)20-7-5-19(18,26)15(22)9-12-3-4-13(23)10-14(12)18/h3-4,10,15,23,26H,2,5-9,11H2,1H3,(H2,20,21,24,25)/t15-,18-,19-/m1/s1 |
| InChIKey | AYAIGAQGMBFHJJ-ATZDWAIDSA-N |
| XLogP | 0.63 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |