C22H29N3O4 — CID 163580176
(1'R,6S,10'S)-17'-ethyl-10'-hydroxy-4'-methoxyspiro[1,3-diazinane-6,13'-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene]-2,4-dione (PubChem CID 163580176) has the molecular formula C22H29N3O4 and a molecular weight of 399.49 g/mol. Its IUPAC name is (1'R,6S,10'S)-17'-ethyl-10'-hydroxy-4'-methoxyspiro[1,3-diazinane-6,13'-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene]-2,4-dione.
| Compound Name | (1'R,6S,10'S)-17'-ethyl-10'-hydroxy-4'-methoxyspiro[1,3-diazinane-6,13'-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene]-2,4-dione |
|---|---|
| PubChem CID | 163580176 |
| Molecular Formula | C22H29N3O4 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | (1'R,6S,10'S)-17'-ethyl-10'-hydroxy-4'-methoxyspiro[1,3-diazinane-6,13'-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene]-2,4-dione |
| SMILES | CCN1CC[C@]23C[C@@]4(CC[C@@]2(O)C1Cc1ccc(OC)cc13)CC(=O)NC(=O)N4 |
| InChI | InChI=1S/C22H29N3O4/c1-3-25-9-8-21-13-20(12-18(26)23-19(27)24-20)6-7-22(21,28)17(25)10-14-4-5-15(29-2)11-16(14)21/h4-5,11,17,28H,3,6-10,12-13H2,1-2H3,(H2,23,24,26,27)/t17?,20-,21-,22-/m1/s1 |
| InChIKey | GGWKSSLRSASVTJ-GJYFWDCESA-N |
| XLogP | 1.47 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |