C27H37N3O4 — CID 90236051
(1R,9R,10S,13S)-17-(cyclopropylmethyl)-1',3'-diethyl-10-hydroxy-4-methoxyspiro[17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-13,5'-imidazolidine]-2',4'-dione (PubChem CID 90236051) has the molecular formula C27H37N3O4 and a molecular weight of 467.61 g/mol. Its IUPAC name is (1R,9R,10S,13S)-17-(cyclopropylmethyl)-1',3'-diethyl-10-hydroxy-4-methoxyspiro[17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-13,5'-imidazolidine]-2',4'-dione.
| Compound Name | (1R,9R,10S,13S)-17-(cyclopropylmethyl)-1',3'-diethyl-10-hydroxy-4-methoxyspiro[17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-13,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 90236051 |
| Molecular Formula | C27H37N3O4 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.28 |
| IUPAC Name | (1R,9R,10S,13S)-17-(cyclopropylmethyl)-1',3'-diethyl-10-hydroxy-4-methoxyspiro[17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-13,5'-imidazolidine]-2',4'-dione |
| SMILES | CCN1C(=O)N(CC)[C@]2(CC[C@@]3(O)[C@H]4Cc5ccc(OC)cc5[C@@]3(CCN4CC3CC3)C2)C1=O |
| InChI | InChI=1S/C27H37N3O4/c1-4-29-23(31)26(30(5-2)24(29)32)10-11-27(33)22-14-19-8-9-20(34-3)15-21(19)25(27,17-26)12-13-28(22)16-18-6-7-18/h8-9,15,18,22,33H,4-7,10-14,16-17H2,1-3H3/t22-,25-,26+,27-/m1/s1 |
| InChIKey | YCBNLFHQURYRKM-DRZCSJLFSA-N |
| XLogP | 2.93 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|