C26H38N4O4 — CID 123265810
17-[2-(dimethylamino)ethyl]-1',3'-diethyl-4,10-dihydroxyspiro[17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-13,5'-imidazolidine]-2',4'-dione (PubChem CID 123265810) has the molecular formula C26H38N4O4 and a molecular weight of 470.61 g/mol. Its IUPAC name is 17-[2-(dimethylamino)ethyl]-1',3'-diethyl-4,10-dihydroxyspiro[17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-13,5'-imidazolidine]-2',4'-dione.
| Compound Name | 17-[2-(dimethylamino)ethyl]-1',3'-diethyl-4,10-dihydroxyspiro[17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-13,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 123265810 |
| Molecular Formula | C26H38N4O4 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.29 |
| IUPAC Name | 17-[2-(dimethylamino)ethyl]-1',3'-diethyl-4,10-dihydroxyspiro[17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-13,5'-imidazolidine]-2',4'-dione |
| SMILES | CCN1C(=O)N(CC)C2(CCC3(O)C4Cc5ccc(O)cc5C3(CCN4CCN(C)C)C2)C1=O |
| InChI | InChI=1S/C26H38N4O4/c1-5-29-22(32)25(30(6-2)23(29)33)9-10-26(34)21-15-18-7-8-19(31)16-20(18)24(26,17-25)11-12-28(21)14-13-27(3)4/h7-8,16,21,31,34H,5-6,9-15,17H2,1-4H3 |
| InChIKey | UIPQRZAJVGOGNL-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 87.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|