C22H32N4O4 — CID 130198547
(1R,10S,11R)-21-[2-(dimethylamino)ethyl]-10,16-dihydroxy-4,6,21-triazatetracyclo[9.7.3.01,10.013,18]henicosa-13(18),14,16-triene-3,5-dione (PubChem CID 130198547) has the molecular formula C22H32N4O4 and a molecular weight of 416.52 g/mol. Its IUPAC name is (1R,10S,11R)-21-[2-(dimethylamino)ethyl]-10,16-dihydroxy-4,6,21-triazatetracyclo[9.7.3.01,10.013,18]henicosa-13(18),14,16-triene-3,5-dione.
| Compound Name | (1R,10S,11R)-21-[2-(dimethylamino)ethyl]-10,16-dihydroxy-4,6,21-triazatetracyclo[9.7.3.01,10.013,18]henicosa-13(18),14,16-triene-3,5-dione |
|---|---|
| PubChem CID | 130198547 |
| Molecular Formula | C22H32N4O4 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | (1R,10S,11R)-21-[2-(dimethylamino)ethyl]-10,16-dihydroxy-4,6,21-triazatetracyclo[9.7.3.01,10.013,18]henicosa-13(18),14,16-triene-3,5-dione |
| SMILES | CN(C)CCN1CC[C@]23CC(=O)NC(=O)NCCC[C@@]2(O)[C@H]1Cc1ccc(O)cc13 |
| InChI | InChI=1S/C22H32N4O4/c1-25(2)10-11-26-9-7-21-14-19(28)24-20(29)23-8-3-6-22(21,30)18(26)12-15-4-5-16(27)13-17(15)21/h4-5,13,18,27,30H,3,6-12,14H2,1-2H3,(H2,23,24,28,29)/t18-,21-,22-/m1/s1 |
| InChIKey | WRNPVOSRUHJINN-STZQEDGTSA-N |
| XLogP | 0.56 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |