C20H24NO4+ — CID 87720913
(1R,10R,11S)-4,11-dihydroxy-18-methyl-18-prop-2-enyl-6-oxa-18-azoniapentacyclo[8.5.3.01,11.02,8.05,7]octadeca-2,4,7-trien-14-one (PubChem CID 87720913) has the molecular formula C20H24NO4+ and a molecular weight of 342.42 g/mol. Its IUPAC name is (1R,10R,11S)-4,11-dihydroxy-18-methyl-18-prop-2-enyl-6-oxa-18-azoniapentacyclo[8.5.3.01,11.02,8.05,7]octadeca-2,4,7-trien-14-one.
| Compound Name | (1R,10R,11S)-4,11-dihydroxy-18-methyl-18-prop-2-enyl-6-oxa-18-azoniapentacyclo[8.5.3.01,11.02,8.05,7]octadeca-2,4,7-trien-14-one |
|---|---|
| PubChem CID | 87720913 |
| Molecular Formula | C20H24NO4+ |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | (1R,10R,11S)-4,11-dihydroxy-18-methyl-18-prop-2-enyl-6-oxa-18-azoniapentacyclo[8.5.3.01,11.02,8.05,7]octadeca-2,4,7-trien-14-one |
| SMILES | C=CC[N+]1(C)CC[C@]23CC(=O)CC[C@@]2(O)[C@H]1Cc1c3cc(O)c2c1O2 |
| InChI | InChI=1S/C20H23NO4/c1-3-7-21(2)8-6-19-11-12(22)4-5-20(19,24)16(21)9-13-14(19)10-15(23)18-17(13)25-18/h3,10,16,24H,1,4-9,11H2,2H3/p+1/t16-,19-,20-,21?/m1/s1 |
| InChIKey | BDBOHRNIXOROIU-SMWDVYHTSA-O |
| XLogP | 2.18 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|