C19H25N2O4Y+ — CID 159492358
(1R,9R,10S)-3,10-dihydroxy-17,17-dimethyl-13-oxo-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-4-carboxamide;yttrium (PubChem CID 159492358) has the molecular formula C19H25N2O4Y+ and a molecular weight of 434.33 g/mol. Its IUPAC name is (1R,9R,10S)-3,10-dihydroxy-17,17-dimethyl-13-oxo-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-4-carboxamide;yttrium.
| Compound Name | (1R,9R,10S)-3,10-dihydroxy-17,17-dimethyl-13-oxo-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-4-carboxamide;yttrium |
|---|---|
| PubChem CID | 159492358 |
| Molecular Formula | C19H25N2O4Y+ |
| Molecular Weight | 434.33 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | (1R,9R,10S)-3,10-dihydroxy-17,17-dimethyl-13-oxo-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-4-carboxamide;yttrium |
| SMILES | C[N+]1(C)CC[C@]23CC(=O)CC[C@@]2(O)[C@H]1Cc1ccc(C(N)=O)c(O)c13.[Y] |
| InChI | InChI=1S/C19H24N2O4.Y/c1-21(2)8-7-18-10-12(22)5-6-19(18,25)14(21)9-11-3-4-13(17(20)24)16(23)15(11)18;/h3-4,14,25H,5-10H2,1-2H3,(H2-,20,23,24);/p+1/t14-,18-,19-;/m1./s1 |
| InChIKey | FKEXEZAVKSFWCR-BMUOBLLISA-O |
| XLogP | 0.62 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.33 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|