C23H33N2O4+ — CID 88950247
[(8aS,9R)-3-carbamoyl-4,8a-dihydroxy-4b-methyl-6-oxo-7,8,9,10-tetrahydro-5H-phenanthren-9-yl]-(cyclobutylmethyl)-dimethylazanium (PubChem CID 88950247) has the molecular formula C23H33N2O4+ and a molecular weight of 401.53 g/mol. Its IUPAC name is [(8aS,9R)-3-carbamoyl-4,8a-dihydroxy-4b-methyl-6-oxo-7,8,9,10-tetrahydro-5H-phenanthren-9-yl]-(cyclobutylmethyl)-dimethylazanium.
| Compound Name | [(8aS,9R)-3-carbamoyl-4,8a-dihydroxy-4b-methyl-6-oxo-7,8,9,10-tetrahydro-5H-phenanthren-9-yl]-(cyclobutylmethyl)-dimethylazanium |
|---|---|
| PubChem CID | 88950247 |
| Molecular Formula | C23H33N2O4+ |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | [(8aS,9R)-3-carbamoyl-4,8a-dihydroxy-4b-methyl-6-oxo-7,8,9,10-tetrahydro-5H-phenanthren-9-yl]-(cyclobutylmethyl)-dimethylazanium |
| SMILES | CC12CC(=O)CC[C@@]1(O)[C@H]([N+](C)(C)CC1CCC1)Cc1ccc(C(N)=O)c(O)c12 |
| InChI | InChI=1S/C23H32N2O4/c1-22-12-16(26)9-10-23(22,29)18(25(2,3)13-14-5-4-6-14)11-15-7-8-17(21(24)28)20(27)19(15)22/h7-8,14,18,29H,4-6,9-13H2,1-3H3,(H2-,24,27,28)/p+1/t18-,22?,23-/m1/s1 |
| InChIKey | UUUQXYJIUKHOTK-GHVLARLOSA-O |
| XLogP | 2.03 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|