C18H26N2O3 — CID 88559003
(8aS,9R)-9-(dimethylamino)-4,8a-dihydroxy-4b-methyl-5,6,7,8,9,10-hexahydrophenanthrene-3-carboxamide (PubChem CID 88559003) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is (8aS,9R)-9-(dimethylamino)-4,8a-dihydroxy-4b-methyl-5,6,7,8,9,10-hexahydrophenanthrene-3-carboxamide.
| Compound Name | (8aS,9R)-9-(dimethylamino)-4,8a-dihydroxy-4b-methyl-5,6,7,8,9,10-hexahydrophenanthrene-3-carboxamide |
|---|---|
| PubChem CID | 88559003 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | (8aS,9R)-9-(dimethylamino)-4,8a-dihydroxy-4b-methyl-5,6,7,8,9,10-hexahydrophenanthrene-3-carboxamide |
| SMILES | CN(C)[C@@H]1Cc2ccc(C(N)=O)c(O)c2C2(C)CCCC[C@@]12O |
| InChI | InChI=1S/C18H26N2O3/c1-17-8-4-5-9-18(17,23)13(20(2)3)10-11-6-7-12(16(19)22)15(21)14(11)17/h6-7,13,21,23H,4-5,8-10H2,1-3H3,(H2,19,22)/t13-,17?,18-/m1/s1 |
| InChIKey | HEKCTIRONHAIHE-IBAPBDAKSA-N |
| XLogP | 1.54 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |