C23H31N2O4Y+ — CID 159835418
(1R,9R,10S)-17-(cyclobutylmethyl)-3,10-dihydroxy-17-methyl-13-oxo-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-4-carboxamide;yttrium (PubChem CID 159835418) has the molecular formula C23H31N2O4Y+ and a molecular weight of 488.42 g/mol. Its IUPAC name is (1R,9R,10S)-17-(cyclobutylmethyl)-3,10-dihydroxy-17-methyl-13-oxo-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-4-carboxamide;yttrium.
| Compound Name | (1R,9R,10S)-17-(cyclobutylmethyl)-3,10-dihydroxy-17-methyl-13-oxo-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-4-carboxamide;yttrium |
|---|---|
| PubChem CID | 159835418 |
| Molecular Formula | C23H31N2O4Y+ |
| Molecular Weight | 488.42 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | (1R,9R,10S)-17-(cyclobutylmethyl)-3,10-dihydroxy-17-methyl-13-oxo-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-4-carboxamide;yttrium |
| SMILES | C[N+]1(CC2CCC2)CC[C@]23CC(=O)CC[C@@]2(O)[C@H]1Cc1ccc(C(N)=O)c(O)c13.[Y] |
| InChI | InChI=1S/C23H30N2O4.Y/c1-25(13-14-3-2-4-14)10-9-22-12-16(26)7-8-23(22,29)18(25)11-15-5-6-17(21(24)28)20(27)19(15)22;/h5-6,14,18,29H,2-4,7-13H2,1H3,(H2-,24,27,28);/p+1/t18-,22-,23-,25?;/m1./s1 |
| InChIKey | SYROQYOUVZMCOW-GZRREDHUSA-O |
| XLogP | 1.79 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.42 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|