C22H32NO2+ — CID 154514281
(1R)-17-(cyclobutylmethyl)-17-methyl-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-4,10-diol (PubChem CID 154514281) has the molecular formula C22H32NO2+ and a molecular weight of 342.50 g/mol. Its IUPAC name is (1R)-17-(cyclobutylmethyl)-17-methyl-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-4,10-diol.
| Compound Name | (1R)-17-(cyclobutylmethyl)-17-methyl-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-4,10-diol |
|---|---|
| PubChem CID | 154514281 |
| Molecular Formula | C22H32NO2+ |
| Molecular Weight | 342.50 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | (1R)-17-(cyclobutylmethyl)-17-methyl-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-4,10-diol |
| SMILES | C[N+]1(CC2CCC2)CC[C@@]23CCCCC2(O)C1Cc1ccc(O)cc13 |
| InChI | InChI=1S/C22H31NO2/c1-23(15-16-5-4-6-16)12-11-21-9-2-3-10-22(21,25)20(23)13-17-7-8-18(24)14-19(17)21/h7-8,14,16,20,25H,2-6,9-13,15H2,1H3/p+1/t20?,21-,22?,23?/m1/s1 |
| InChIKey | KTSQAHHGCQEHQT-YQEOXULRSA-O |
| XLogP | 3.51 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.50 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|