C21H30N2O4 — CID 146259311
3-[(1R,2S)-1-[2-(cyclopropylmethylamino)ethyl]-2-hydroxy-2-methyl-5-oxocyclohexyl]-2-hydroxy-4-methylbenzamide (PubChem CID 146259311) has the molecular formula C21H30N2O4 and a molecular weight of 374.48 g/mol. Its IUPAC name is 3-[(1R,2S)-1-[2-(cyclopropylmethylamino)ethyl]-2-hydroxy-2-methyl-5-oxocyclohexyl]-2-hydroxy-4-methylbenzamide.
| Compound Name | 3-[(1R,2S)-1-[2-(cyclopropylmethylamino)ethyl]-2-hydroxy-2-methyl-5-oxocyclohexyl]-2-hydroxy-4-methylbenzamide |
|---|---|
| PubChem CID | 146259311 |
| Molecular Formula | C21H30N2O4 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | 3-[(1R,2S)-1-[2-(cyclopropylmethylamino)ethyl]-2-hydroxy-2-methyl-5-oxocyclohexyl]-2-hydroxy-4-methylbenzamide |
| SMILES | Cc1ccc(C(N)=O)c(O)c1[C@@]1(CCNCC2CC2)CC(=O)CC[C@]1(C)O |
| InChI | InChI=1S/C21H30N2O4/c1-13-3-6-16(19(22)26)18(25)17(13)21(9-10-23-12-14-4-5-14)11-15(24)7-8-20(21,2)27/h3,6,14,23,25,27H,4-5,7-12H2,1-2H3,(H2,22,26)/t20-,21+/m0/s1 |
| InChIKey | AGBQRWDYGGDKBK-LEWJYISDSA-N |
| XLogP | 1.93 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|