C21H27N4O3+ — CID 123628987
(1R,9R,10S)-13-hydrazinylidene-3,10-dihydroxy-17-methyl-17-prop-2-enyl-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraene-4-carboxamide (PubChem CID 123628987) has the molecular formula C21H27N4O3+ and a molecular weight of 383.47 g/mol. Its IUPAC name is (1R,9R,10S)-13-hydrazinylidene-3,10-dihydroxy-17-methyl-17-prop-2-enyl-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraene-4-carboxamide.
| Compound Name | (1R,9R,10S)-13-hydrazinylidene-3,10-dihydroxy-17-methyl-17-prop-2-enyl-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraene-4-carboxamide |
|---|---|
| PubChem CID | 123628987 |
| Molecular Formula | C21H27N4O3+ |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | (1R,9R,10S)-13-hydrazinylidene-3,10-dihydroxy-17-methyl-17-prop-2-enyl-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraene-4-carboxamide |
| SMILES | C=CC[N+]1(C)CC[C@]23CC(=NN)C=C[C@@]2(O)[C@H]1Cc1ccc(C(N)=O)c(O)c13 |
| InChI | InChI=1S/C21H26N4O3/c1-3-9-25(2)10-8-20-12-14(24-23)6-7-21(20,28)16(25)11-13-4-5-15(19(22)27)18(26)17(13)20/h3-7,16,28H,1,8-12,23H2,2H3,(H2-,22,26,27)/p+1/t16-,20-,21-,25?/m1/s1 |
| InChIKey | VMPQWAOPIZWYHR-ZLLIHNSESA-O |
| XLogP | 0.70 |
| TPSA | 121.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|