C21H27N2O3+ — CID 143765078
(1S,9R,13R)-3,13-dihydroxy-17-methyl-17-prop-2-enyl-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraene-4-carboxamide (PubChem CID 143765078) has the molecular formula C21H27N2O3+ and a molecular weight of 355.46 g/mol. Its IUPAC name is (1S,9R,13R)-3,13-dihydroxy-17-methyl-17-prop-2-enyl-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraene-4-carboxamide.
| Compound Name | (1S,9R,13R)-3,13-dihydroxy-17-methyl-17-prop-2-enyl-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraene-4-carboxamide |
|---|---|
| PubChem CID | 143765078 |
| Molecular Formula | C21H27N2O3+ |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | (1S,9R,13R)-3,13-dihydroxy-17-methyl-17-prop-2-enyl-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraene-4-carboxamide |
| SMILES | C=CC[N+]1(C)CC[C@]23C[C@@H](O)C=CC2[C@H]1Cc1ccc(C(N)=O)c(O)c13 |
| InChI | InChI=1S/C21H26N2O3/c1-3-9-23(2)10-8-21-12-14(24)5-7-16(21)17(23)11-13-4-6-15(20(22)26)19(25)18(13)21/h3-7,14,16-17,24H,1,8-12H2,2H3,(H2-,22,25,26)/p+1/t14-,16?,17+,21-,23?/m0/s1 |
| InChIKey | MTHLKARUXKAKSA-FGGXQDOASA-O |
| XLogP | 1.63 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|