C20H28NO+ — CID 50917086
(1S,9S,10R,17R)-17-methyl-17-prop-2-enyl-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol (PubChem CID 50917086) has the molecular formula C20H28NO+ and a molecular weight of 298.45 g/mol. Its IUPAC name is (1S,9S,10R,17R)-17-methyl-17-prop-2-enyl-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol.
| Compound Name | (1S,9S,10R,17R)-17-methyl-17-prop-2-enyl-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol |
|---|---|
| PubChem CID | 50917086 |
| Molecular Formula | C20H28NO+ |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.22 |
| IUPAC Name | (1S,9S,10R,17R)-17-methyl-17-prop-2-enyl-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol |
| SMILES | C=CC[N@@+]1(C)CC[C@@]23CCCC[C@H]2[C@@H]1Cc1ccc(O)cc13 |
| InChI | InChI=1S/C20H27NO/c1-3-11-21(2)12-10-20-9-5-4-6-17(20)19(21)13-15-7-8-16(22)14-18(15)20/h3,7-8,14,17,19H,1,4-6,9-13H2,2H3/p+1/t17-,19-,20-,21-/m0/s1 |
| InChIKey | ZGVNXEGEOHMRML-VMXMFDLUSA-O |
| XLogP | 3.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|