C17H24NO+ — CID 6556524
(1R,9R,10S)-17-methyl-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol (PubChem CID 6556524) has the molecular formula C17H24NO+ and a molecular weight of 258.38 g/mol. Its IUPAC name is (1R,9R,10S)-17-methyl-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol.
| Compound Name | (1R,9R,10S)-17-methyl-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol |
|---|---|
| PubChem CID | 6556524 |
| Molecular Formula | C17H24NO+ |
| Molecular Weight | 258.38 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | (1R,9R,10S)-17-methyl-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol |
| SMILES | C[NH+]1CC[C@]23CCCC[C@@H]2[C@H]1Cc1ccc(O)cc13 |
| InChI | InChI=1S/C17H23NO/c1-18-9-8-17-7-3-2-4-14(17)16(18)10-12-5-6-13(19)11-15(12)17/h5-6,11,14,16,19H,2-4,7-10H2,1H3/p+1/t14-,16-,17-/m1/s1 |
| InChIKey | JAQUASYNZVUNQP-DJIMGWMZSA-O |
| XLogP | 1.66 |
| TPSA | 24.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.38 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |