C18H26NO+ — CID 59745526
(1R,9R,10R)-17,17-dimethyl-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol (PubChem CID 59745526) has the molecular formula C18H26NO+ and a molecular weight of 272.41 g/mol. Its IUPAC name is (1R,9R,10R)-17,17-dimethyl-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol.
| Compound Name | (1R,9R,10R)-17,17-dimethyl-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol |
|---|---|
| PubChem CID | 59745526 |
| Molecular Formula | C18H26NO+ |
| Molecular Weight | 272.41 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | (1R,9R,10R)-17,17-dimethyl-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol |
| SMILES | C[N+]1(C)CC[C@]23CCCC[C@H]2[C@H]1Cc1ccc(O)cc13 |
| InChI | InChI=1S/C18H25NO/c1-19(2)10-9-18-8-4-3-5-15(18)17(19)11-13-6-7-14(20)12-16(13)18/h6-7,12,15,17H,3-5,8-11H2,1-2H3/p+1/t15-,17+,18+/m0/s1 |
| InChIKey | YJSZGPNVWVYXJS-CGTJXYLNSA-O |
| XLogP | 3.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.41 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|