C22H30O — CID 129253369
(1R,9S,10S)-17-(cyclobutylmethyl)tetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol (PubChem CID 129253369) has the molecular formula C22H30O and a molecular weight of 310.48 g/mol. Its IUPAC name is (1R,9S,10S)-17-(cyclobutylmethyl)tetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol.
| Compound Name | (1R,9S,10S)-17-(cyclobutylmethyl)tetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol |
|---|---|
| PubChem CID | 129253369 |
| Molecular Formula | C22H30O |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | (1R,9S,10S)-17-(cyclobutylmethyl)tetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol |
| SMILES | Oc1ccc2c(c1)[C@@]13CCCC[C@H]1[C@@H](C2)C(CC1CCC1)CC3 |
| InChI | InChI=1S/C22H30O/c23-18-8-7-17-13-19-16(12-15-4-3-5-15)9-11-22(21(17)14-18)10-2-1-6-20(19)22/h7-8,14-16,19-20,23H,1-6,9-13H2/t16?,19-,20-,22+/m0/s1 |
| InChIKey | JSOBGPHOWDPRBS-HTVIDTJGSA-N |
| XLogP | 5.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |