C22H32O — CID 163481967
(1R,9S)-17-[(2R)-pentan-2-yl]tetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol (PubChem CID 163481967) has the molecular formula C22H32O and a molecular weight of 312.50 g/mol. Its IUPAC name is (1R,9S)-17-[(2R)-pentan-2-yl]tetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol.
| Compound Name | (1R,9S)-17-[(2R)-pentan-2-yl]tetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol |
|---|---|
| PubChem CID | 163481967 |
| Molecular Formula | C22H32O |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | (1R,9S)-17-[(2R)-pentan-2-yl]tetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol |
| SMILES | CCC[C@@H](C)C1CC[C@]23CCCCC2[C@H]1Cc1ccc(O)cc13 |
| InChI | InChI=1S/C22H32O/c1-3-6-15(2)18-10-12-22-11-5-4-7-20(22)19(18)13-16-8-9-17(23)14-21(16)22/h8-9,14-15,18-20,23H,3-7,10-13H2,1-2H3/t15-,18?,19+,20?,22-/m1/s1 |
| InChIKey | CFIDOBRDSNLMTO-KJSBBWFXSA-N |
| XLogP | 5.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |