C18H25NO — CID 88878035
(1S)-4,17-dimethyl-17-oxido-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene (PubChem CID 88878035) has the molecular formula C18H25NO and a molecular weight of 271.40 g/mol. Its IUPAC name is (1S)-4,17-dimethyl-17-oxido-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene.
| Compound Name | (1S)-4,17-dimethyl-17-oxido-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 88878035 |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | (1S)-4,17-dimethyl-17-oxido-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene |
| SMILES | Cc1ccc2c(c1)[C@]13CCCCC1C(C2)[N+](C)([O-])CC3 |
| InChI | InChI=1S/C18H25NO/c1-13-6-7-14-12-17-15-5-3-4-8-18(15,16(14)11-13)9-10-19(17,2)20/h6-7,11,15,17H,3-5,8-10,12H2,1-2H3/t15?,17?,18-,19?/m0/s1 |
| InChIKey | WBVCDMPEBKLIPZ-BNQPFWKLSA-N |
| XLogP | 3.70 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|