C21H25N2O6+ — CID 87306419
[2-[(4R,4aR,7S,7aR,12bS)-7,9-dihydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-3-yl]acetyl] 2-aminoacetate (PubChem CID 87306419) has the molecular formula C21H25N2O6+ and a molecular weight of 401.44 g/mol. Its IUPAC name is [2-[(4R,4aR,7S,7aR,12bS)-7,9-dihydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-3-yl]acetyl] 2-aminoacetate.
| Compound Name | [2-[(4R,4aR,7S,7aR,12bS)-7,9-dihydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-3-yl]acetyl] 2-aminoacetate |
|---|---|
| PubChem CID | 87306419 |
| Molecular Formula | C21H25N2O6+ |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | [2-[(4R,4aR,7S,7aR,12bS)-7,9-dihydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-3-yl]acetyl] 2-aminoacetate |
| SMILES | C[N+]1(CC(=O)OC(=O)CN)CC[C@]23c4c5ccc(O)c4O[C@H]2[C@@H](O)C=C[C@H]3[C@H]1C5 |
| InChI | InChI=1S/C21H24N2O6/c1-23(10-17(27)28-16(26)9-22)7-6-21-12-3-5-15(25)20(21)29-19-14(24)4-2-11(18(19)21)8-13(12)23/h2-5,12-13,15,20,25H,6-10,22H2,1H3/p+1/t12-,13+,15-,20-,21-,23?/m0/s1 |
| InChIKey | HPTKMCCUALUHNF-ZAASKBLJSA-O |
| XLogP | -0.26 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|