C16H16O3 — CID 142881385
(1S,4R,12R,13S)-11-oxapentacyclo[8.6.1.01,12.04,16.06,17]heptadeca-6(17),7,9,14-tetraene-9,13-diol (PubChem CID 142881385) has the molecular formula C16H16O3 and a molecular weight of 256.30 g/mol. Its IUPAC name is (1S,4R,12R,13S)-11-oxapentacyclo[8.6.1.01,12.04,16.06,17]heptadeca-6(17),7,9,14-tetraene-9,13-diol.
| Compound Name | (1S,4R,12R,13S)-11-oxapentacyclo[8.6.1.01,12.04,16.06,17]heptadeca-6(17),7,9,14-tetraene-9,13-diol |
|---|---|
| PubChem CID | 142881385 |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | (1S,4R,12R,13S)-11-oxapentacyclo[8.6.1.01,12.04,16.06,17]heptadeca-6(17),7,9,14-tetraene-9,13-diol |
| SMILES | Oc1ccc2c3c1O[C@H]1[C@@H](O)C=CC4[C@H](CC[C@@]341)C2 |
| InChI | InChI=1S/C16H16O3/c17-11-3-1-9-7-8-5-6-16-10(8)2-4-12(18)15(16)19-14(11)13(9)16/h1-4,8,10,12,15,17-18H,5-7H2/t8-,10?,12+,15+,16+/m1/s1 |
| InChIKey | MJEMRTQOWGYLFO-OSFYGRGTSA-N |
| XLogP | 1.90 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|