C32H34N2O4 — CID 121296940
(1S,9R,13R)-3,13-dihydroxy-N-[2-[4-(4-hydroxyphenyl)phenyl]ethyl]-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraene-4-carboxamide (PubChem CID 121296940) has the molecular formula C32H34N2O4 and a molecular weight of 510.63 g/mol. Its IUPAC name is (1S,9R,13R)-3,13-dihydroxy-N-[2-[4-(4-hydroxyphenyl)phenyl]ethyl]-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraene-4-carboxamide.
| Compound Name | (1S,9R,13R)-3,13-dihydroxy-N-[2-[4-(4-hydroxyphenyl)phenyl]ethyl]-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraene-4-carboxamide |
|---|---|
| PubChem CID | 121296940 |
| Molecular Formula | C32H34N2O4 |
| Molecular Weight | 510.63 g/mol |
| Exact Mass | 510.25 |
| IUPAC Name | (1S,9R,13R)-3,13-dihydroxy-N-[2-[4-(4-hydroxyphenyl)phenyl]ethyl]-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraene-4-carboxamide |
| SMILES | CN1CC[C@]23C[C@@H](O)C=CC2[C@H]1Cc1ccc(C(=O)NCCc2ccc(-c4ccc(O)cc4)cc2)c(O)c13 |
| InChI | InChI=1S/C32H34N2O4/c1-34-17-15-32-19-25(36)11-13-27(32)28(34)18-23-8-12-26(30(37)29(23)32)31(38)33-16-14-20-2-4-21(5-3-20)22-6-9-24(35)10-7-22/h2-13,25,27-28,35-37H,14-19H2,1H3,(H,33,38)/t25-,27?,28+,32-/m0/s1 |
| InChIKey | KRWZOAXICBOHIZ-JRKCYPPSSA-N |
| XLogP | 4.17 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.63 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|