C33H36N2O4 — CID 123313329
3-hydroxy-N-[2-[4-(4-hydroxyphenyl)phenyl]ethyl]-13-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraene-4-carboxamide (PubChem CID 123313329) has the molecular formula C33H36N2O4 and a molecular weight of 524.66 g/mol. Its IUPAC name is 3-hydroxy-N-[2-[4-(4-hydroxyphenyl)phenyl]ethyl]-13-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraene-4-carboxamide.
| Compound Name | 3-hydroxy-N-[2-[4-(4-hydroxyphenyl)phenyl]ethyl]-13-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraene-4-carboxamide |
|---|---|
| PubChem CID | 123313329 |
| Molecular Formula | C33H36N2O4 |
| Molecular Weight | 524.66 g/mol |
| Exact Mass | 524.27 |
| IUPAC Name | 3-hydroxy-N-[2-[4-(4-hydroxyphenyl)phenyl]ethyl]-13-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraene-4-carboxamide |
| SMILES | COC1C=CC2C3Cc4ccc(C(=O)NCCc5ccc(-c6ccc(O)cc6)cc5)c(O)c4C2(CCN3C)C1 |
| InChI | InChI=1S/C33H36N2O4/c1-35-18-16-33-20-26(39-2)12-14-28(33)29(35)19-24-9-13-27(31(37)30(24)33)32(38)34-17-15-21-3-5-22(6-4-21)23-7-10-25(36)11-8-23/h3-14,26,28-29,36-37H,15-20H2,1-2H3,(H,34,38) |
| InChIKey | DTKSCXLPTMJRDF-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.66 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|