C28H34FNO4 — CID 144507559
17-(cyclopropylmethyl)-13-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraene-3,4-diol;(4-fluorophenyl)methanol (PubChem CID 144507559) has the molecular formula C28H34FNO4 and a molecular weight of 467.58 g/mol. Its IUPAC name is 17-(cyclopropylmethyl)-13-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraene-3,4-diol;(4-fluorophenyl)methanol.
| Compound Name | 17-(cyclopropylmethyl)-13-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraene-3,4-diol;(4-fluorophenyl)methanol |
|---|---|
| PubChem CID | 144507559 |
| Molecular Formula | C28H34FNO4 |
| Molecular Weight | 467.58 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | 17-(cyclopropylmethyl)-13-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraene-3,4-diol;(4-fluorophenyl)methanol |
| SMILES | COC1C=CC2C3Cc4ccc(O)c(O)c4C2(CCN3CC2CC2)C1.OCc1ccc(F)cc1 |
| InChI | InChI=1S/C21H27NO3.C7H7FO/c1-25-15-5-6-16-17-10-14-4-7-18(23)20(24)19(14)21(16,11-15)8-9-22(17)12-13-2-3-13;8-7-3-1-6(5-9)2-4-7/h4-7,13,15-17,23-24H,2-3,8-12H2,1H3;1-4,9H,5H2 |
| InChIKey | OBBJCPPCRHOHOS-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.58 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|