C21H25NO3 — CID 142473821
17-(cyclopropylmethyl)-13-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,10,12-pentaene-3,4-diol (PubChem CID 142473821) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is 17-(cyclopropylmethyl)-13-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,10,12-pentaene-3,4-diol.
| Compound Name | 17-(cyclopropylmethyl)-13-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,10,12-pentaene-3,4-diol |
|---|---|
| PubChem CID | 142473821 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 17-(cyclopropylmethyl)-13-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,10,12-pentaene-3,4-diol |
| SMILES | COC1=CC=C2C3Cc4ccc(O)c(O)c4C2(CCN3CC2CC2)C1 |
| InChI | InChI=1S/C21H25NO3/c1-25-15-5-6-16-17-10-14-4-7-18(23)20(24)19(14)21(16,11-15)8-9-22(17)12-13-2-3-13/h4-7,13,17,23-24H,2-3,8-12H2,1H3 |
| InChIKey | NAISEPDMEUOXAD-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|