C28H36N2O7 — CID 88529444
methyl 1-[[(1R,9R,10S,14R)-17-(cyclopropylmethyl)-3,4,10,13-tetrahydroxy-14-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,12-tetraene-12-carbonyl]amino]cyclobutane-1-carboxylate (PubChem CID 88529444) has the molecular formula C28H36N2O7 and a molecular weight of 512.60 g/mol. Its IUPAC name is methyl 1-[[(1R,9R,10S,14R)-17-(cyclopropylmethyl)-3,4,10,13-tetrahydroxy-14-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,12-tetraene-12-carbonyl]amino]cyclobutane-1-carboxylate.
| Compound Name | methyl 1-[[(1R,9R,10S,14R)-17-(cyclopropylmethyl)-3,4,10,13-tetrahydroxy-14-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,12-tetraene-12-carbonyl]amino]cyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 88529444 |
| Molecular Formula | C28H36N2O7 |
| Molecular Weight | 512.60 g/mol |
| Exact Mass | 512.25 |
| IUPAC Name | methyl 1-[[(1R,9R,10S,14R)-17-(cyclopropylmethyl)-3,4,10,13-tetrahydroxy-14-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,12-tetraene-12-carbonyl]amino]cyclobutane-1-carboxylate |
| SMILES | COC(=O)C1(NC(=O)C2=C(O)[C@H](C)[C@]34CCN(CC5CC5)[C@H](Cc5ccc(O)c(O)c53)[C@]4(O)C2)CCC1 |
| InChI | InChI=1S/C28H36N2O7/c1-15-22(32)18(24(34)29-26(8-3-9-26)25(35)37-2)13-28(36)20-12-17-6-7-19(31)23(33)21(17)27(15,28)10-11-30(20)14-16-4-5-16/h6-7,15-16,20,31-33,36H,3-5,8-14H2,1-2H3,(H,29,34)/t15-,20+,27+,28+/m0/s1 |
| InChIKey | WXQWVUMFMSPTLZ-ZLQIIECISA-N |
| XLogP | 2.17 |
| TPSA | 139.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.60 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|