C31H32N4O4 — CID 88529435
(1R,2R,13S,14R)-24-(cyclopropylmethyl)-13,19,20-trihydroxy-2-methyl-7-phenyl-4,8,9,24-tetrazahexacyclo[12.7.3.01,13.03,11.05,9.016,21]tetracosa-3(11),4,6,16(21),17,19-hexaen-10-one (PubChem CID 88529435) has the molecular formula C31H32N4O4 and a molecular weight of 524.62 g/mol. Its IUPAC name is (1R,2R,13S,14R)-24-(cyclopropylmethyl)-13,19,20-trihydroxy-2-methyl-7-phenyl-4,8,9,24-tetrazahexacyclo[12.7.3.01,13.03,11.05,9.016,21]tetracosa-3(11),4,6,16(21),17,19-hexaen-10-one.
| Compound Name | (1R,2R,13S,14R)-24-(cyclopropylmethyl)-13,19,20-trihydroxy-2-methyl-7-phenyl-4,8,9,24-tetrazahexacyclo[12.7.3.01,13.03,11.05,9.016,21]tetracosa-3(11),4,6,16(21),17,19-hexaen-10-one |
|---|---|
| PubChem CID | 88529435 |
| Molecular Formula | C31H32N4O4 |
| Molecular Weight | 524.62 g/mol |
| Exact Mass | 524.24 |
| IUPAC Name | (1R,2R,13S,14R)-24-(cyclopropylmethyl)-13,19,20-trihydroxy-2-methyl-7-phenyl-4,8,9,24-tetrazahexacyclo[12.7.3.01,13.03,11.05,9.016,21]tetracosa-3(11),4,6,16(21),17,19-hexaen-10-one |
| SMILES | C[C@H]1c2nc3cc(-c4ccccc4)[nH]n3c(=O)c2C[C@@]2(O)[C@H]3Cc4ccc(O)c(O)c4[C@@]12CCN3CC1CC1 |
| InChI | InChI=1S/C31H32N4O4/c1-17-27-21(29(38)35-25(32-27)14-22(33-35)19-5-3-2-4-6-19)15-31(39)24-13-20-9-10-23(36)28(37)26(20)30(17,31)11-12-34(24)16-18-7-8-18/h2-6,9-10,14,17-18,24,33,36-37,39H,7-8,11-13,15-16H2,1H3/t17-,24+,30+,31+/m0/s1 |
| InChIKey | AYOUSMJDDVKHID-YAAANJTBSA-N |
| XLogP | 3.47 |
| TPSA | 114.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.62 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|