C28H36N2O7 — CID 88529450
1-[(1R,9R,10S,14R)-17-(cyclopropylmethyl)-3,4,10,13-tetrahydroxy-14-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,12-tetraene-12-carbonyl]piperidine-4-carboxylic acid (PubChem CID 88529450) has the molecular formula C28H36N2O7 and a molecular weight of 512.60 g/mol. Its IUPAC name is 1-[(1R,9R,10S,14R)-17-(cyclopropylmethyl)-3,4,10,13-tetrahydroxy-14-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,12-tetraene-12-carbonyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[(1R,9R,10S,14R)-17-(cyclopropylmethyl)-3,4,10,13-tetrahydroxy-14-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,12-tetraene-12-carbonyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 88529450 |
| Molecular Formula | C28H36N2O7 |
| Molecular Weight | 512.60 g/mol |
| Exact Mass | 512.25 |
| IUPAC Name | 1-[(1R,9R,10S,14R)-17-(cyclopropylmethyl)-3,4,10,13-tetrahydroxy-14-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,12-tetraene-12-carbonyl]piperidine-4-carboxylic acid |
| SMILES | C[C@H]1C(O)=C(C(=O)N2CCC(C(=O)O)CC2)C[C@@]2(O)[C@H]3Cc4ccc(O)c(O)c4[C@@]12CCN3CC1CC1 |
| InChI | InChI=1S/C28H36N2O7/c1-15-23(32)19(25(34)29-9-6-17(7-10-29)26(35)36)13-28(37)21-12-18-4-5-20(31)24(33)22(18)27(15,28)8-11-30(21)14-16-2-3-16/h4-5,15-17,21,31-33,37H,2-3,6-14H2,1H3,(H,35,36)/t15-,21+,27+,28+/m0/s1 |
| InChIKey | FIKBLYRGEFZQDF-CPDDIUBASA-N |
| XLogP | 2.28 |
| TPSA | 141.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.60 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|