C28H35N3O5 — CID 58615159
1-[(2E)-2-[(4R,4aS,7aS,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-ylidene]acetyl]piperidine-4-carboxamide (PubChem CID 58615159) has the molecular formula C28H35N3O5 and a molecular weight of 493.60 g/mol. Its IUPAC name is 1-[(2E)-2-[(4R,4aS,7aS,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-ylidene]acetyl]piperidine-4-carboxamide.
| Compound Name | 1-[(2E)-2-[(4R,4aS,7aS,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-ylidene]acetyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 58615159 |
| Molecular Formula | C28H35N3O5 |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.26 |
| IUPAC Name | 1-[(2E)-2-[(4R,4aS,7aS,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-ylidene]acetyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(C(=O)/C=C2\CC[C@@]3(O)[C@H]4Cc5ccc(O)c6c5[C@@]3(CCN4CC3CC3)[C@H]2O6)CC1 |
| InChI | InChI=1S/C28H35N3O5/c29-26(34)17-6-10-30(11-7-17)22(33)14-19-5-8-28(35)21-13-18-3-4-20(32)24-23(18)27(28,25(19)36-24)9-12-31(21)15-16-1-2-16/h3-4,14,16-17,21,25,32,35H,1-2,5-13,15H2,(H2,29,34)/b19-14+/t21-,25+,27+,28-/m1/s1 |
| InChIKey | AIKKJYPDWUQUTN-FZHJEMERSA-N |
| XLogP | 1.61 |
| TPSA | 116.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|