C30H41NO5 — CID 144875271
(6R,7aS)-3-(cyclopropylmethyl)-6-(furan-3-ylmethoxymethyl)-7-methoxy-6-methyl-1,2,4,4a,5,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-ol;ethane (PubChem CID 144875271) has the molecular formula C30H41NO5 and a molecular weight of 495.66 g/mol. Its IUPAC name is (6R,7aS)-3-(cyclopropylmethyl)-6-(furan-3-ylmethoxymethyl)-7-methoxy-6-methyl-1,2,4,4a,5,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-ol;ethane.
| Compound Name | (6R,7aS)-3-(cyclopropylmethyl)-6-(furan-3-ylmethoxymethyl)-7-methoxy-6-methyl-1,2,4,4a,5,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-ol;ethane |
|---|---|
| PubChem CID | 144875271 |
| Molecular Formula | C30H41NO5 |
| Molecular Weight | 495.66 g/mol |
| Exact Mass | 495.30 |
| IUPAC Name | (6R,7aS)-3-(cyclopropylmethyl)-6-(furan-3-ylmethoxymethyl)-7-methoxy-6-methyl-1,2,4,4a,5,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-ol;ethane |
| SMILES | CC.COC1[C@H]2Oc3c(O)ccc4c3C23CCN(CC2CC2)C(C4)C3C[C@]1(C)COCc1ccoc1 |
| InChI | InChI=1S/C28H35NO5.C2H6/c1-27(16-33-15-18-7-10-32-14-18)12-20-21-11-19-5-6-22(30)24-23(19)28(20,26(34-24)25(27)31-2)8-9-29(21)13-17-3-4-17;1-2/h5-7,10,14,17,20-21,25-26,30H,3-4,8-9,11-13,15-16H2,1-2H3;1-2H3/t20?,21?,25?,26-,27-,28?;/m1./s1 |
| InChIKey | RXTBKSUXEWRWAO-KGAYNLNWSA-N |
| XLogP | 5.31 |
| TPSA | 64.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.66 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |